C16H26O2 — CID 173094615
hexadeca-2,4,13-trienoic acid (PubChem CID 173094615) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is hexadeca-2,4,13-trienoic acid.
| Compound Name | hexadeca-2,4,13-trienoic acid |
|---|---|
| PubChem CID | 173094615 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | hexadeca-2,4,13-trienoic acid |
| SMILES | CCC=CCCCCCCCC=CC=CC(=O)O |
| InChI | InChI=1S/C16H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h3-4,12-15H,2,5-11H2,1H3,(H,17,18) |
| InChIKey | AMWLIXYIWISOEX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|