About 8-chlorooct-4-en-3-ol
8-chlorooct-4-en-3-ol (PubChem CID 71392279) has the molecular formula C8H15ClO
and a molecular weight of 162.66 g/mol. Its IUPAC name is 8-chlorooct-4-en-3-ol.
Molecular Properties
| Compound Name | 8-chlorooct-4-en-3-ol |
| PubChem CID | 71392279 |
| Molecular Formula | C8H15ClO |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 8-chlorooct-4-en-3-ol |
| SMILES | CCC(O)C=CCCCCl |
| InChI | InChI=1S/C8H15ClO/c1-2-8(10)6-4-3-5-7-9/h4,6,8,10H,2-3,5,7H2,1H3 |
| InChIKey | MZUQMIZNXWGKTP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-chlorooct-4-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chlorooct-4-en-3-ol?
The IUPAC name of 8-chlorooct-4-en-3-ol (CID 71392279) is 8-chlorooct-4-en-3-ol.
What is the SMILES notation for 8-chlorooct-4-en-3-ol?
The canonical SMILES for 8-chlorooct-4-en-3-ol is CCC(O)C=CCCCCl.
What is the InChIKey of 8-chlorooct-4-en-3-ol?
The InChIKey is MZUQMIZNXWGKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO/c1-2-8(10)6-4-3-5-7-9/h4,6,8,10H,2-3,5,7H2,1H3.
What are the key properties of 8-chlorooct-4-en-3-ol?
8-chlorooct-4-en-3-ol has a molecular weight of 162.66 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chlorooct-4-en-3-ol is sourced from PubChem (CID 71392279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).