C35H62O5 — CID 163428427
(Z,4S,5S)-4,5-dimethylhept-2-enal;(3Z,5R,6S)-5,6-dimethylocta-1,3-diene;(Z,4S,5R)-5-hydroxy-4-methylhept-2-enal;(Z,4R,5R)-5-hydroxy-4-methylhept-2-enal (PubChem CID 163428427) has the molecular formula C35H62O5 and a molecular weight of 562.88 g/mol. Its IUPAC name is (Z,4S,5S)-4,5-dimethylhept-2-enal;(3Z,5R,6S)-5,6-dimethylocta-1,3-diene;(Z,4S,5R)-5-hydroxy-4-methylhept-2-enal;(Z,4R,5R)-5-hydroxy-4-methylhept-2-enal.
| Compound Name | (Z,4S,5S)-4,5-dimethylhept-2-enal;(3Z,5R,6S)-5,6-dimethylocta-1,3-diene;(Z,4S,5R)-5-hydroxy-4-methylhept-2-enal;(Z,4R,5R)-5-hydroxy-4-methylhept-2-enal |
|---|---|
| PubChem CID | 163428427 |
| Molecular Formula | C35H62O5 |
| Molecular Weight | 562.88 g/mol |
| Exact Mass | 562.46 |
| IUPAC Name | (Z,4S,5S)-4,5-dimethylhept-2-enal;(3Z,5R,6S)-5,6-dimethylocta-1,3-diene;(Z,4S,5R)-5-hydroxy-4-methylhept-2-enal;(Z,4R,5R)-5-hydroxy-4-methylhept-2-enal |
| SMILES | C=C/C=C\[C@H](C)[C@@H](C)CC.CC[C@@H](O)[C@@H](C)/C=C\C=O.CC[C@@H](O)[C@H](C)/C=C\C=O.CC[C@H](C)[C@H](C)/C=C\C=O |
| InChI | InChI=1S/C10H18.C9H16O.2C8H14O2/c1-5-7-8-10(4)9(3)6-2;1-4-8(2)9(3)6-5-7-10;2*1-3-8(10)7(2)5-4-6-9/h5,7-10H,1,6H2,2-4H3;5-9H,4H2,1-3H3;2*4-8,10H,3H2,1-2H3/b8-7-;6-5-;2*5-4-/t9-,10-;8-,9+;7-,8+;7-,8-/m0001/s1 |
| InChIKey | AOMIQPCMDSTKFN-AWWLDZMRSA-N |
| XLogP | 8.13 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.88 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|