C14H21IO2 — CID 135040191
(2E,4S,5S,7E,10E)-5-hydroxy-11-iodo-4,8,10-trimethylundeca-2,7,10-trienal (PubChem CID 135040191) has the molecular formula C14H21IO2 and a molecular weight of 348.22 g/mol. Its IUPAC name is (2E,4S,5S,7E,10E)-5-hydroxy-11-iodo-4,8,10-trimethylundeca-2,7,10-trienal.
| Compound Name | (2E,4S,5S,7E,10E)-5-hydroxy-11-iodo-4,8,10-trimethylundeca-2,7,10-trienal |
|---|---|
| PubChem CID | 135040191 |
| Molecular Formula | C14H21IO2 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (2E,4S,5S,7E,10E)-5-hydroxy-11-iodo-4,8,10-trimethylundeca-2,7,10-trienal |
| SMILES | C/C(=C\I)C/C(C)=C/C[C@H](O)[C@@H](C)/C=C/C=O |
| InChI | InChI=1S/C14H21IO2/c1-11(9-12(2)10-15)6-7-14(17)13(3)5-4-8-16/h4-6,8,10,13-14,17H,7,9H2,1-3H3/b5-4+,11-6+,12-10+/t13-,14-/m0/s1 |
| InChIKey | QPGQXCFMOKPMPI-XVZWATHPSA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|