C7H11IO — CID 124658711
(E,2S)-5-iodo-2,4-dimethylpent-4-enal (PubChem CID 124658711) has the molecular formula C7H11IO and a molecular weight of 238.07 g/mol. Its IUPAC name is (E,2S)-5-iodo-2,4-dimethylpent-4-enal.
| Compound Name | (E,2S)-5-iodo-2,4-dimethylpent-4-enal |
|---|---|
| PubChem CID | 124658711 |
| Molecular Formula | C7H11IO |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | (E,2S)-5-iodo-2,4-dimethylpent-4-enal |
| SMILES | C/C(=C\I)CC(C)C=O |
| InChI | InChI=1S/C7H11IO/c1-6(4-8)3-7(2)5-9/h4-5,7H,3H2,1-2H3/b6-4+ |
| InChIKey | DRZQHAAFHLVMLP-GQCTYLIASA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|