C6H11IO2 — CID 11149183
(Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol (PubChem CID 11149183) has the molecular formula C6H11IO2 and a molecular weight of 242.06 g/mol. Its IUPAC name is (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol.
| Compound Name | (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 11149183 |
| Molecular Formula | C6H11IO2 |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol |
| SMILES | C/C(=C/I)C[C@H](O)CO |
| InChI | InChI=1S/C6H11IO2/c1-5(3-7)2-6(9)4-8/h3,6,8-9H,2,4H2,1H3/b5-3-/t6-/m0/s1 |
| InChIKey | QLQNUZMXCHCJMC-LMXCLXGDSA-N |
| XLogP | 1.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|