About (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol
(Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol (PubChem CID 11149183) has the molecular formula C6H11IO2
and a molecular weight of 242.06 g/mol. Its IUPAC name is (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol.
Molecular Properties
| Compound Name | (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol |
| PubChem CID | 11149183 |
| Molecular Formula | C6H11IO2 |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol |
| SMILES | C/C(=C/I)C[C@H](O)CO |
| InChI | InChI=1S/C6H11IO2/c1-5(3-7)2-6(9)4-8/h3,6,8-9H,2,4H2,1H3/b5-3-/t6-/m0/s1 |
| InChIKey | QLQNUZMXCHCJMC-LMXCLXGDSA-N |
| XLogP | 1.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol?
The IUPAC name of (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol (CID 11149183) is (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol.
What is the SMILES notation for (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol?
The canonical SMILES for (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol is C/C(=C/I)C[C@H](O)CO.
What is the InChIKey of (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol?
The InChIKey is QLQNUZMXCHCJMC-LMXCLXGDSA-N. The full InChI is InChI=1S/C6H11IO2/c1-5(3-7)2-6(9)4-8/h3,6,8-9H,2,4H2,1H3/b5-3-/t6-/m0/s1.
What are the key properties of (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol?
(Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol has a molecular weight of 242.06 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2S)-5-iodo-4-methylpent-4-ene-1,2-diol is sourced from PubChem (CID 11149183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).