C7H12O4 — CID 58618706
(6S)-6,7-dihydroxyheptane-3,4-dione (PubChem CID 58618706) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is (6S)-6,7-dihydroxyheptane-3,4-dione.
| Compound Name | (6S)-6,7-dihydroxyheptane-3,4-dione |
|---|---|
| PubChem CID | 58618706 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (6S)-6,7-dihydroxyheptane-3,4-dione |
| SMILES | CCC(=O)C(=O)C[C@H](O)CO |
| InChI | InChI=1S/C7H12O4/c1-2-6(10)7(11)3-5(9)4-8/h5,8-9H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | KXZPHJPQSGLHCN-YFKPBYRVSA-N |
| XLogP | -0.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|