About N-ethyl-3,4-dihydroxybutanamide
N-ethyl-3,4-dihydroxybutanamide (PubChem CID 18386927) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is N-ethyl-3,4-dihydroxybutanamide.
Molecular Properties
| Compound Name | N-ethyl-3,4-dihydroxybutanamide |
| PubChem CID | 18386927 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | N-ethyl-3,4-dihydroxybutanamide |
| SMILES | CCNC(=O)CC(O)CO |
| InChI | InChI=1S/C6H13NO3/c1-2-7-6(10)3-5(9)4-8/h5,8-9H,2-4H2,1H3,(H,7,10) |
| InChIKey | GUZHWHSNZJZQPY-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-3,4-dihydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,4-dihydroxybutanamide?
The IUPAC name of N-ethyl-3,4-dihydroxybutanamide (CID 18386927) is N-ethyl-3,4-dihydroxybutanamide.
What is the SMILES notation for N-ethyl-3,4-dihydroxybutanamide?
The canonical SMILES for N-ethyl-3,4-dihydroxybutanamide is CCNC(=O)CC(O)CO.
What is the InChIKey of N-ethyl-3,4-dihydroxybutanamide?
The InChIKey is GUZHWHSNZJZQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c1-2-7-6(10)3-5(9)4-8/h5,8-9H,2-4H2,1H3,(H,7,10).
What are the key properties of N-ethyl-3,4-dihydroxybutanamide?
N-ethyl-3,4-dihydroxybutanamide has a molecular weight of 147.17 g/mol, XLogP of -1.13, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,4-dihydroxybutanamide is sourced from PubChem (CID 18386927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).