C8H18N2O3 — CID 87957366
(3S)-N-[1-(dimethylamino)ethyl]-3,4-dihydroxybutanamide (PubChem CID 87957366) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3S)-N-[1-(dimethylamino)ethyl]-3,4-dihydroxybutanamide.
| Compound Name | (3S)-N-[1-(dimethylamino)ethyl]-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 87957366 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (3S)-N-[1-(dimethylamino)ethyl]-3,4-dihydroxybutanamide |
| SMILES | CC(NC(=O)C[C@H](O)CO)N(C)C |
| InChI | InChI=1S/C8H18N2O3/c1-6(10(2)3)9-8(13)4-7(12)5-11/h6-7,11-12H,4-5H2,1-3H3,(H,9,13)/t6?,7-/m0/s1 |
| InChIKey | JVFYIWGTZDQCCN-MLWJPKLSSA-N |
| XLogP | -1.25 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|