C8H16O3 — CID 168860493
(5S)-1,2-dihydroxy-5-methylheptan-4-one (PubChem CID 168860493) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (5S)-1,2-dihydroxy-5-methylheptan-4-one.
| Compound Name | (5S)-1,2-dihydroxy-5-methylheptan-4-one |
|---|---|
| PubChem CID | 168860493 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (5S)-1,2-dihydroxy-5-methylheptan-4-one |
| SMILES | CC[C@H](C)C(=O)CC(O)CO |
| InChI | InChI=1S/C8H16O3/c1-3-6(2)8(11)4-7(10)5-9/h6-7,9-10H,3-5H2,1-2H3/t6-,7?/m0/s1 |
| InChIKey | CJZUHDLUVJFNST-PKPIPKONSA-N |
| XLogP | 0.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |