About 3-methyloctan-4-one;yttrium
3-methyloctan-4-one;yttrium (PubChem CID 58599912) has the molecular formula C9H17OY-
and a molecular weight of 230.14 g/mol. Its IUPAC name is 3-methyloctan-4-one;yttrium.
Molecular Properties
| Compound Name | 3-methyloctan-4-one;yttrium |
| PubChem CID | 58599912 |
| Molecular Formula | C9H17OY- |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-methyloctan-4-one;yttrium |
| SMILES | CC[CH-]CC(=O)C(C)CC.[Y] |
| InChI | InChI=1S/C9H17O.Y/c1-4-6-7-9(10)8(3)5-2;/h6,8H,4-5,7H2,1-3H3;/q-1; |
| InChIKey | NFXKYVQNMTYTRF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methyloctan-4-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyloctan-4-one;yttrium?
The IUPAC name of 3-methyloctan-4-one;yttrium (CID 58599912) is 3-methyloctan-4-one;yttrium.
What is the SMILES notation for 3-methyloctan-4-one;yttrium?
The canonical SMILES for 3-methyloctan-4-one;yttrium is CC[CH-]CC(=O)C(C)CC.[Y].
What is the InChIKey of 3-methyloctan-4-one;yttrium?
The InChIKey is NFXKYVQNMTYTRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17O.Y/c1-4-6-7-9(10)8(3)5-2;/h6,8H,4-5,7H2,1-3H3;/q-1;.
What are the key properties of 3-methyloctan-4-one;yttrium?
3-methyloctan-4-one;yttrium has a molecular weight of 230.14 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyloctan-4-one;yttrium is sourced from PubChem (CID 58599912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).