About methane;5-methyl-4-oxoheptanoic acid;yttrium
methane;5-methyl-4-oxoheptanoic acid;yttrium (PubChem CID 158695550) has the molecular formula C10H21O3Y-
and a molecular weight of 278.18 g/mol. Its IUPAC name is methane;5-methyl-4-oxoheptanoic acid;yttrium.
Molecular Properties
| Compound Name | methane;5-methyl-4-oxoheptanoic acid;yttrium |
| PubChem CID | 158695550 |
| Molecular Formula | C10H21O3Y- |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | methane;5-methyl-4-oxoheptanoic acid;yttrium |
| SMILES | C.C.CCC(C)C(=O)C[CH-]C(=O)O.[Y] |
| InChI | InChI=1S/C8H13O3.2CH4.Y/c1-3-6(2)7(9)4-5-8(10)11;;;/h5-6H,3-4H2,1-2H3,(H,10,11);2*1H4;/q-1;;; |
| InChIKey | FSSNBXXXKXXOTD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methane;5-methyl-4-oxoheptanoic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-methyl-4-oxoheptanoic acid;yttrium?
The IUPAC name of methane;5-methyl-4-oxoheptanoic acid;yttrium (CID 158695550) is methane;5-methyl-4-oxoheptanoic acid;yttrium.
What is the SMILES notation for methane;5-methyl-4-oxoheptanoic acid;yttrium?
The canonical SMILES for methane;5-methyl-4-oxoheptanoic acid;yttrium is C.C.CCC(C)C(=O)C[CH-]C(=O)O.[Y].
What is the InChIKey of methane;5-methyl-4-oxoheptanoic acid;yttrium?
The InChIKey is FSSNBXXXKXXOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O3.2CH4.Y/c1-3-6(2)7(9)4-5-8(10)11;;;/h5-6H,3-4H2,1-2H3,(H,10,11);2*1H4;/q-1;;;.
What are the key properties of methane;5-methyl-4-oxoheptanoic acid;yttrium?
methane;5-methyl-4-oxoheptanoic acid;yttrium has a molecular weight of 278.18 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-methyl-4-oxoheptanoic acid;yttrium is sourced from PubChem (CID 158695550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).