C11H15NO3 — CID 69242116
N-benzyl-3,4-dihydroxybutanamide (PubChem CID 69242116) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-benzyl-3,4-dihydroxybutanamide.
| Compound Name | N-benzyl-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 69242116 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-benzyl-3,4-dihydroxybutanamide |
| SMILES | O=C(CC(O)CO)NCc1ccccc1 |
| InChI | InChI=1S/C11H15NO3/c13-8-10(14)6-11(15)12-7-9-4-2-1-3-5-9/h1-5,10,13-14H,6-8H2,(H,12,15) |
| InChIKey | VBXGCLMWKLDOEZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |