C11H17N3O — CID 57016843
3,4-diamino-N-benzylbutanamide (PubChem CID 57016843) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3,4-diamino-N-benzylbutanamide.
| Compound Name | 3,4-diamino-N-benzylbutanamide |
|---|---|
| PubChem CID | 57016843 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3,4-diamino-N-benzylbutanamide |
| SMILES | NCC(N)CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C11H17N3O/c12-7-10(13)6-11(15)14-8-9-4-2-1-3-5-9/h1-5,10H,6-8,12-13H2,(H,14,15) |
| InChIKey | LKORDMVHTGVBDX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |