C7H14N2O3 — CID 175280437
3-amino-5,6-dihydroxy-2-methylhex-2-enamide (PubChem CID 175280437) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-amino-5,6-dihydroxy-2-methylhex-2-enamide.
| Compound Name | 3-amino-5,6-dihydroxy-2-methylhex-2-enamide |
|---|---|
| PubChem CID | 175280437 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 3-amino-5,6-dihydroxy-2-methylhex-2-enamide |
| SMILES | CC(C(N)=O)=C(N)CC(O)CO |
| InChI | InChI=1S/C7H14N2O3/c1-4(7(9)12)6(8)2-5(11)3-10/h5,10-11H,2-3,8H2,1H3,(H2,9,12) |
| InChIKey | DINVNJBDPXVZTF-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|