About (E)-1-iodo-2,4-dimethylpent-1-ene
(E)-1-iodo-2,4-dimethylpent-1-ene (PubChem CID 58173205) has the molecular formula C7H13I
and a molecular weight of 224.08 g/mol. Its IUPAC name is (E)-1-iodo-2,4-dimethylpent-1-ene.
Molecular Properties
| Compound Name | (E)-1-iodo-2,4-dimethylpent-1-ene |
| PubChem CID | 58173205 |
| Molecular Formula | C7H13I |
| Molecular Weight | 224.08 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | (E)-1-iodo-2,4-dimethylpent-1-ene |
| SMILES | C/C(=C\I)CC(C)C |
| InChI | InChI=1S/C7H13I/c1-6(2)4-7(3)5-8/h5-6H,4H2,1-3H3/b7-5+ |
| InChIKey | LDJLJEFWOKDYGS-FNORWQNLSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.08 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-iodo-2,4-dimethylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-iodo-2,4-dimethylpent-1-ene?
The IUPAC name of (E)-1-iodo-2,4-dimethylpent-1-ene (CID 58173205) is (E)-1-iodo-2,4-dimethylpent-1-ene.
What is the SMILES notation for (E)-1-iodo-2,4-dimethylpent-1-ene?
The canonical SMILES for (E)-1-iodo-2,4-dimethylpent-1-ene is C/C(=C\I)CC(C)C.
What is the InChIKey of (E)-1-iodo-2,4-dimethylpent-1-ene?
The InChIKey is LDJLJEFWOKDYGS-FNORWQNLSA-N. The full InChI is InChI=1S/C7H13I/c1-6(2)4-7(3)5-8/h5-6H,4H2,1-3H3/b7-5+.
What are the key properties of (E)-1-iodo-2,4-dimethylpent-1-ene?
(E)-1-iodo-2,4-dimethylpent-1-ene has a molecular weight of 224.08 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-iodo-2,4-dimethylpent-1-ene is sourced from PubChem (CID 58173205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).