C8H16O — CID 13415310
(E)-3,5-dimethylhex-2-en-1-ol (PubChem CID 13415310) has the molecular formula C8H16O and a molecular weight of 128.21 g/mol. Its IUPAC name is (E)-3,5-dimethylhex-2-en-1-ol.
| Compound Name | (E)-3,5-dimethylhex-2-en-1-ol |
|---|---|
| PubChem CID | 13415310 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (E)-3,5-dimethylhex-2-en-1-ol |
| SMILES | C/C(=C\CO)CC(C)C |
| InChI | InChI=1S/C8H16O/c1-7(2)6-8(3)4-5-9/h4,7,9H,5-6H2,1-3H3/b8-4+ |
| InChIKey | JIQWNHHUDWOKMU-XBXARRHUSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|