About (E)-3,5-dimethylhex-2-en-1-ol
(E)-3,5-dimethylhex-2-en-1-ol (PubChem CID 13415310) has the molecular formula C8H16O
and a molecular weight of 128.21 g/mol. Its IUPAC name is (E)-3,5-dimethylhex-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-3,5-dimethylhex-2-en-1-ol |
| PubChem CID | 13415310 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (E)-3,5-dimethylhex-2-en-1-ol |
| SMILES | C/C(=C\CO)CC(C)C |
| InChI | InChI=1S/C8H16O/c1-7(2)6-8(3)4-5-9/h4,7,9H,5-6H2,1-3H3/b8-4+ |
| InChIKey | JIQWNHHUDWOKMU-XBXARRHUSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,5-dimethylhex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,5-dimethylhex-2-en-1-ol?
The IUPAC name of (E)-3,5-dimethylhex-2-en-1-ol (CID 13415310) is (E)-3,5-dimethylhex-2-en-1-ol.
What is the SMILES notation for (E)-3,5-dimethylhex-2-en-1-ol?
The canonical SMILES for (E)-3,5-dimethylhex-2-en-1-ol is C/C(=C\CO)CC(C)C.
What is the InChIKey of (E)-3,5-dimethylhex-2-en-1-ol?
The InChIKey is JIQWNHHUDWOKMU-XBXARRHUSA-N. The full InChI is InChI=1S/C8H16O/c1-7(2)6-8(3)4-5-9/h4,7,9H,5-6H2,1-3H3/b8-4+.
What are the key properties of (E)-3,5-dimethylhex-2-en-1-ol?
(E)-3,5-dimethylhex-2-en-1-ol has a molecular weight of 128.21 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,5-dimethylhex-2-en-1-ol is sourced from PubChem (CID 13415310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).