C9H17Cl — CID 79603963
1-chloro-4,6-dimethylhept-3-ene (PubChem CID 79603963) has the molecular formula C9H17Cl and a molecular weight of 160.69 g/mol. Its IUPAC name is 1-chloro-4,6-dimethylhept-3-ene.
| Compound Name | 1-chloro-4,6-dimethylhept-3-ene |
|---|---|
| PubChem CID | 79603963 |
| Molecular Formula | C9H17Cl |
| Molecular Weight | 160.69 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-chloro-4,6-dimethylhept-3-ene |
| SMILES | CC(=CCCCl)CC(C)C |
| InChI | InChI=1S/C9H17Cl/c1-8(2)7-9(3)5-4-6-10/h5,8H,4,6-7H2,1-3H3 |
| InChIKey | ISKVPMWZDPDSOU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.69 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|