C9H18O2 — CID 163319747
(E,5R)-3-methyloct-2-ene-1,5-diol (PubChem CID 163319747) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (E,5R)-3-methyloct-2-ene-1,5-diol.
| Compound Name | (E,5R)-3-methyloct-2-ene-1,5-diol |
|---|---|
| PubChem CID | 163319747 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (E,5R)-3-methyloct-2-ene-1,5-diol |
| SMILES | CCC[C@@H](O)C/C(C)=C/CO |
| InChI | InChI=1S/C9H18O2/c1-3-4-9(11)7-8(2)5-6-10/h5,9-11H,3-4,6-7H2,1-2H3/b8-5+/t9-/m1/s1 |
| InChIKey | TTZJMGMFVPXQIP-WHXYTISESA-N |
| XLogP | 1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|