C10H17Ac2BrO2 — CID 59931094
actinium;(2E,6E)-8-bromo-3,7-dimethylocta-2,6-diene-1,5-diol (PubChem CID 59931094) has the molecular formula C10H17Ac2BrO2 and a molecular weight of 703.15 g/mol. Its IUPAC name is actinium;(2E,6E)-8-bromo-3,7-dimethylocta-2,6-diene-1,5-diol.
| Compound Name | actinium;(2E,6E)-8-bromo-3,7-dimethylocta-2,6-diene-1,5-diol |
|---|---|
| PubChem CID | 59931094 |
| Molecular Formula | C10H17Ac2BrO2 |
| Molecular Weight | 703.15 g/mol |
| Exact Mass | 702.10 |
| IUPAC Name | actinium;(2E,6E)-8-bromo-3,7-dimethylocta-2,6-diene-1,5-diol |
| SMILES | C/C(=C\C(O)C/C(C)=C/CO)CBr.[Ac].[Ac] |
| InChI | InChI=1S/C10H17BrO2.2Ac/c1-8(3-4-12)5-10(13)6-9(2)7-11;;/h3,6,10,12-13H,4-5,7H2,1-2H3;;/b8-3+,9-6+;; |
| InChIKey | OPTDOQLMTGCAOE-UKNZWUACSA-N |
| XLogP | 2.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|