C20H34O3 — CID 162864992
9-(3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl)-3,7-dimethylnona-2,6-diene-1,5-diol (PubChem CID 162864992) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 9-(3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl)-3,7-dimethylnona-2,6-diene-1,5-diol.
| Compound Name | 9-(3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl)-3,7-dimethylnona-2,6-diene-1,5-diol |
|---|---|
| PubChem CID | 162864992 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 9-(3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl)-3,7-dimethylnona-2,6-diene-1,5-diol |
| SMILES | C=C1CCC(O)C(C)(C)C1CCC(C)=CC(O)CC(C)=CCO |
| InChI | InChI=1S/C20H34O3/c1-14(12-17(22)13-15(2)10-11-21)6-8-18-16(3)7-9-19(23)20(18,4)5/h10,12,17-19,21-23H,3,6-9,11,13H2,1-2,4-5H3 |
| InChIKey | GJVACEQURBYCMH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|