C20H34O4 — CID 75069287
4-(hydroxymethyl)-8-(5-hydroxy-3-methylpent-3-enyl)-4,8a-dimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene-2,6-diol (PubChem CID 75069287) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 4-(hydroxymethyl)-8-(5-hydroxy-3-methylpent-3-enyl)-4,8a-dimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene-2,6-diol.
| Compound Name | 4-(hydroxymethyl)-8-(5-hydroxy-3-methylpent-3-enyl)-4,8a-dimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene-2,6-diol |
|---|---|
| PubChem CID | 75069287 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 4-(hydroxymethyl)-8-(5-hydroxy-3-methylpent-3-enyl)-4,8a-dimethyl-7-methylidene-2,3,4a,5,6,8-hexahydro-1H-naphthalene-2,6-diol |
| SMILES | C=C1C(O)CC2C(C)(CO)CC(O)CC2(C)C1CCC(C)=CCO |
| InChI | InChI=1S/C20H34O4/c1-13(7-8-21)5-6-16-14(2)17(24)9-18-19(3,12-22)10-15(23)11-20(16,18)4/h7,15-18,21-24H,2,5-6,8-12H2,1,3-4H3 |
| InChIKey | LCWHTWNKEOSQBZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|