C27H44O6 — CID 23872136
[(E)-5-[(1R,5S,8aS)-5-(acetyloxymethyl)-3,7-dihydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl] 2-methylbutanoate (PubChem CID 23872136) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is [(E)-5-[(1R,5S,8aS)-5-(acetyloxymethyl)-3,7-dihydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl] 2-methylbutanoate.
| Compound Name | [(E)-5-[(1R,5S,8aS)-5-(acetyloxymethyl)-3,7-dihydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 23872136 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | [(E)-5-[(1R,5S,8aS)-5-(acetyloxymethyl)-3,7-dihydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl] 2-methylbutanoate |
| SMILES | C=C1C(O)CC2[C@@](C)(COC(C)=O)CC(O)C[C@]2(C)[C@H]1CC/C(C)=C/COC(=O)C(C)CC |
| InChI | InChI=1S/C27H44O6/c1-8-18(3)25(31)32-12-11-17(2)9-10-22-19(4)23(30)13-24-26(6,16-33-20(5)28)14-21(29)15-27(22,24)7/h11,18,21-24,29-30H,4,8-10,12-16H2,1-3,5-7H3/b17-11+/t18?,21?,22-,23?,24?,26+,27+/m0/s1 |
| InChIKey | PQCWDDLBWXLLJD-OOWYUEPQSA-N |
| XLogP | 4.59 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|