C25H42O3 — CID 162876763
[5-(6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl] 3-methylbutanoate (PubChem CID 162876763) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is [5-(6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl] 3-methylbutanoate.
| Compound Name | [5-(6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 162876763 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | [5-(6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl] 3-methylbutanoate |
| SMILES | CC(=CCOC(=O)CC(C)C)CCC1C(C)=CCC2C(C)(C)C(O)CCC12C |
| InChI | InChI=1S/C25H42O3/c1-17(2)16-23(27)28-15-13-18(3)8-10-20-19(4)9-11-21-24(5,6)22(26)12-14-25(20,21)7/h9,13,17,20-22,26H,8,10-12,14-16H2,1-7H3 |
| InChIKey | BENJKNYADAOTQA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|