C26H44O3 — CID 163105562
5-[5-(6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enoxy]-4-methylpentan-2-one (PubChem CID 163105562) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is 5-[5-(6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enoxy]-4-methylpentan-2-one.
| Compound Name | 5-[5-(6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enoxy]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 163105562 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 5-[5-(6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enoxy]-4-methylpentan-2-one |
| SMILES | CC(=O)CC(C)COCC=C(C)CCC1C(C)=CCC2C(C)(C)C(O)CCC12C |
| InChI | InChI=1S/C26H44O3/c1-18(13-15-29-17-19(2)16-21(4)27)8-10-22-20(3)9-11-23-25(5,6)24(28)12-14-26(22,23)7/h9,13,19,22-24,28H,8,10-12,14-17H2,1-7H3 |
| InChIKey | PSCPTEHCJTYRLJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|