C11H19BrO — CID 59970319
(2E,6E)-1-bromo-2,6-dimethylnona-2,6-dien-4-ol (PubChem CID 59970319) has the molecular formula C11H19BrO and a molecular weight of 247.18 g/mol. Its IUPAC name is (2E,6E)-1-bromo-2,6-dimethylnona-2,6-dien-4-ol.
| Compound Name | (2E,6E)-1-bromo-2,6-dimethylnona-2,6-dien-4-ol |
|---|---|
| PubChem CID | 59970319 |
| Molecular Formula | C11H19BrO |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (2E,6E)-1-bromo-2,6-dimethylnona-2,6-dien-4-ol |
| SMILES | CC/C=C(\C)CC(O)/C=C(\C)CBr |
| InChI | InChI=1S/C11H19BrO/c1-4-5-9(2)6-11(13)7-10(3)8-12/h5,7,11,13H,4,6,8H2,1-3H3/b9-5+,10-7+ |
| InChIKey | XDBMDYRQXQKTFQ-FWMCCXIMSA-N |
| XLogP | 3.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|