C9H16Br2 — CID 54067675
1,4-dibromo-2,6-dimethylhept-2-ene (PubChem CID 54067675) has the molecular formula C9H16Br2 and a molecular weight of 284.04 g/mol. Its IUPAC name is 1,4-dibromo-2,6-dimethylhept-2-ene.
| Compound Name | 1,4-dibromo-2,6-dimethylhept-2-ene |
|---|---|
| PubChem CID | 54067675 |
| Molecular Formula | C9H16Br2 |
| Molecular Weight | 284.04 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | 1,4-dibromo-2,6-dimethylhept-2-ene |
| SMILES | CC(=CC(Br)CC(C)C)CBr |
| InChI | InChI=1S/C9H16Br2/c1-7(2)4-9(11)5-8(3)6-10/h5,7,9H,4,6H2,1-3H3 |
| InChIKey | MEEJQDAPHQFVTO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.04 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|