C13H17Br — CID 11097089
[(E,2R)-5-bromo-2,4-dimethylpent-3-enyl]benzene (PubChem CID 11097089) has the molecular formula C13H17Br and a molecular weight of 253.18 g/mol. Its IUPAC name is [(E,2R)-5-bromo-2,4-dimethylpent-3-enyl]benzene.
| Compound Name | [(E,2R)-5-bromo-2,4-dimethylpent-3-enyl]benzene |
|---|---|
| PubChem CID | 11097089 |
| Molecular Formula | C13H17Br |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | [(E,2R)-5-bromo-2,4-dimethylpent-3-enyl]benzene |
| SMILES | C/C(=C\[C@H](C)Cc1ccccc1)CBr |
| InChI | InChI=1S/C13H17Br/c1-11(8-12(2)10-14)9-13-6-4-3-5-7-13/h3-8,11H,9-10H2,1-2H3/b12-8+/t11-/m0/s1 |
| InChIKey | REQVOZASDAUMLJ-SERMCNLOSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|