C10H20 — CID 558039
2,4,6-trimethylhept-2-ene (PubChem CID 558039) has the molecular formula C10H20 and a molecular weight of 140.27 g/mol. Its IUPAC name is 2,4,6-trimethylhept-2-ene.
| Compound Name | 2,4,6-trimethylhept-2-ene |
|---|---|
| PubChem CID | 558039 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | 2,4,6-trimethylhept-2-ene |
| SMILES | CC(C)=CC(C)CC(C)C |
| InChI | InChI=1S/C10H20/c1-8(2)6-10(5)7-9(3)4/h6,9-10H,7H2,1-5H3 |
| InChIKey | MHVHINAAFJWQPK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|