C12H23Cl — CID 86260523
8-chloro-2,4,6-trimethylnon-2-ene (PubChem CID 86260523) has the molecular formula C12H23Cl and a molecular weight of 202.77 g/mol. Its IUPAC name is 8-chloro-2,4,6-trimethylnon-2-ene.
| Compound Name | 8-chloro-2,4,6-trimethylnon-2-ene |
|---|---|
| PubChem CID | 86260523 |
| Molecular Formula | C12H23Cl |
| Molecular Weight | 202.77 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 8-chloro-2,4,6-trimethylnon-2-ene |
| SMILES | CC(C)=CC(C)CC(C)CC(C)Cl |
| InChI | InChI=1S/C12H23Cl/c1-9(2)6-10(3)7-11(4)8-12(5)13/h6,10-12H,7-8H2,1-5H3 |
| InChIKey | YZLJCLLUVUYXQE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.77 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|