C12H19ClO — CID 10910907
(2E,4R,6S)-4,6,8-trimethylnona-2,7-dienoyl chloride (PubChem CID 10910907) has the molecular formula C12H19ClO and a molecular weight of 214.74 g/mol. Its IUPAC name is (2E,4R,6S)-4,6,8-trimethylnona-2,7-dienoyl chloride.
| Compound Name | (2E,4R,6S)-4,6,8-trimethylnona-2,7-dienoyl chloride |
|---|---|
| PubChem CID | 10910907 |
| Molecular Formula | C12H19ClO |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (2E,4R,6S)-4,6,8-trimethylnona-2,7-dienoyl chloride |
| SMILES | CC(C)=C[C@@H](C)C[C@@H](C)/C=C/C(=O)Cl |
| InChI | InChI=1S/C12H19ClO/c1-9(2)7-11(4)8-10(3)5-6-12(13)14/h5-7,10-11H,8H2,1-4H3/b6-5+/t10-,11+/m0/s1 |
| InChIKey | STQBHVBXBOJQPG-PFDYWKIBSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|