C12H24 — CID 59787440
(4R,6S)-2,4,6,7-tetramethyloct-2-ene (PubChem CID 59787440) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is (4R,6S)-2,4,6,7-tetramethyloct-2-ene.
| Compound Name | (4R,6S)-2,4,6,7-tetramethyloct-2-ene |
|---|---|
| PubChem CID | 59787440 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | (4R,6S)-2,4,6,7-tetramethyloct-2-ene |
| SMILES | CC(C)=C[C@H](C)C[C@H](C)C(C)C |
| InChI | InChI=1S/C12H24/c1-9(2)7-11(5)8-12(6)10(3)4/h7,10-12H,8H2,1-6H3/t11-,12-/m0/s1 |
| InChIKey | JVPDBOOJOGRDQQ-RYUDHWBXSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|