C21H40Lu — CID 57404171
2,4-dimethylpent-2-ene;lutetium;2,4,7,9-tetramethyldeca-2,8-diene (PubChem CID 57404171) has the molecular formula C21H40Lu and a molecular weight of 467.52 g/mol. Its IUPAC name is 2,4-dimethylpent-2-ene;lutetium;2,4,7,9-tetramethyldeca-2,8-diene.
| Compound Name | 2,4-dimethylpent-2-ene;lutetium;2,4,7,9-tetramethyldeca-2,8-diene |
|---|---|
| PubChem CID | 57404171 |
| Molecular Formula | C21H40Lu |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 2,4-dimethylpent-2-ene;lutetium;2,4,7,9-tetramethyldeca-2,8-diene |
| SMILES | CC(C)=CC(C)C.CC(C)=CC(C)CCC(C)C=C(C)C.[Lu] |
| InChI | InChI=1S/C14H26.C7H14.Lu/c1-11(2)9-13(5)7-8-14(6)10-12(3)4;1-6(2)5-7(3)4;/h9-10,13-14H,7-8H2,1-6H3;5-6H,1-4H3; |
| InChIKey | NMKCHEVKXQJGCJ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|