C14H21BrO4 — CID 11427577
[(2E,6E)-5-acetyloxy-8-bromo-3,7-dimethylocta-2,6-dienyl] acetate (PubChem CID 11427577) has the molecular formula C14H21BrO4 and a molecular weight of 333.22 g/mol. Its IUPAC name is [(2E,6E)-5-acetyloxy-8-bromo-3,7-dimethylocta-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-5-acetyloxy-8-bromo-3,7-dimethylocta-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 11427577 |
| Molecular Formula | C14H21BrO4 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [(2E,6E)-5-acetyloxy-8-bromo-3,7-dimethylocta-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC(/C=C(\C)CBr)OC(C)=O |
| InChI | InChI=1S/C14H21BrO4/c1-10(5-6-18-12(3)16)7-14(19-13(4)17)8-11(2)9-15/h5,8,14H,6-7,9H2,1-4H3/b10-5+,11-8+ |
| InChIKey | NZFILGMGMURFIS-TVNUJMIRSA-N |
| XLogP | 3.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|