C31H44O6S — CID 54029570
[5-acetyloxy-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraenyl] acetate (PubChem CID 54029570) has the molecular formula C31H44O6S and a molecular weight of 544.75 g/mol. Its IUPAC name is [5-acetyloxy-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraenyl] acetate.
| Compound Name | [5-acetyloxy-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 54029570 |
| Molecular Formula | C31H44O6S |
| Molecular Weight | 544.75 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | [5-acetyloxy-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraenyl] acetate |
| SMILES | CC(=O)OCC=C(C)CC(C=C(C)CC(C=C(C)CCC=C(C)C)S(=O)(=O)c1ccc(C)cc1)OC(C)=O |
| InChI | InChI=1S/C31H44O6S/c1-22(2)10-9-11-24(4)20-31(38(34,35)30-14-12-23(3)13-15-30)21-26(6)19-29(37-28(8)33)18-25(5)16-17-36-27(7)32/h10,12-16,19-20,29,31H,9,11,17-18,21H2,1-8H3 |
| InChIKey | LEPYAFDYJLRFHY-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.75 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|