About (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide
(3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide (PubChem CID 163561617) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide.
Molecular Properties
| Compound Name | (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide |
| PubChem CID | 163561617 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide |
| SMILES | CCN(C)C(=O)CC(C)C=O |
| InChI | InChI=1S/C8H15NO2/c1-4-9(3)8(11)5-7(2)6-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | FRRLPWNFBYPLMH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide?
The IUPAC name of (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide (CID 163561617) is (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide.
What is the SMILES notation for (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide?
The canonical SMILES for (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide is CCN(C)C(=O)CC(C)C=O.
What is the InChIKey of (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide?
The InChIKey is FRRLPWNFBYPLMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-4-9(3)8(11)5-7(2)6-10/h6-7H,4-5H2,1-3H3.
What are the key properties of (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide?
(3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide has a molecular weight of 157.21 g/mol, XLogP of 0.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-ethyl-N,3-dimethyl-4-oxobutanamide is sourced from PubChem (CID 163561617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).