C9H18O — CID 12703990
(3R,4R,5S)-3,5-dimethylhept-1-en-4-ol (PubChem CID 12703990) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (3R,4R,5S)-3,5-dimethylhept-1-en-4-ol.
| Compound Name | (3R,4R,5S)-3,5-dimethylhept-1-en-4-ol |
|---|---|
| PubChem CID | 12703990 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (3R,4R,5S)-3,5-dimethylhept-1-en-4-ol |
| SMILES | C=C[C@@H](C)[C@H](O)[C@@H](C)CC |
| InChI | InChI=1S/C9H18O/c1-5-7(3)9(10)8(4)6-2/h5,7-10H,1,6H2,2-4H3/t7-,8+,9+/m1/s1 |
| InChIKey | MVTVDAPLCOTIFV-VGMNWLOBSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|