C15H30O — CID 24854557
(3R,4S,5R)-3,5-dimethyltridec-1-en-4-ol (PubChem CID 24854557) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is (3R,4S,5R)-3,5-dimethyltridec-1-en-4-ol.
| Compound Name | (3R,4S,5R)-3,5-dimethyltridec-1-en-4-ol |
|---|---|
| PubChem CID | 24854557 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | (3R,4S,5R)-3,5-dimethyltridec-1-en-4-ol |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@H](C)CCCCCCCC |
| InChI | InChI=1S/C15H30O/c1-5-7-8-9-10-11-12-14(4)15(16)13(3)6-2/h6,13-16H,2,5,7-12H2,1,3-4H3/t13-,14-,15-/m1/s1 |
| InChIKey | ZUJLEVBTELPKHU-RBSFLKMASA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|