C9H18O2 — CID 100972297
(2R,3R,4S,5S)-3,5-dimethylhept-6-ene-2,4-diol (PubChem CID 100972297) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (2R,3R,4S,5S)-3,5-dimethylhept-6-ene-2,4-diol.
| Compound Name | (2R,3R,4S,5S)-3,5-dimethylhept-6-ene-2,4-diol |
|---|---|
| PubChem CID | 100972297 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (2R,3R,4S,5S)-3,5-dimethylhept-6-ene-2,4-diol |
| SMILES | C=C[C@H](C)[C@H](O)[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C9H18O2/c1-5-6(2)9(11)7(3)8(4)10/h5-11H,1H2,2-4H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | PKBWVERHAPBFGC-KDXUFGMBSA-N |
| XLogP | 1.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|