C8H19NO — CID 65190310
1-amino-2,4-dimethylhexan-3-ol (PubChem CID 65190310) has the molecular formula C8H19NO and a molecular weight of 145.25 g/mol. Its IUPAC name is 1-amino-2,4-dimethylhexan-3-ol.
| Compound Name | 1-amino-2,4-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 65190310 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 1-amino-2,4-dimethylhexan-3-ol |
| SMILES | CCC(C)C(O)C(C)CN |
| InChI | InChI=1S/C8H19NO/c1-4-6(2)8(10)7(3)5-9/h6-8,10H,4-5,9H2,1-3H3 |
| InChIKey | WSSVCXFYLRWUHL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |