C18H33FO — CID 143351155
ethane;(5Z,7Z)-3-fluoro-4-methyldeca-5,7,9-trien-2-one;2-methylbutane (PubChem CID 143351155) has the molecular formula C18H33FO and a molecular weight of 284.46 g/mol. Its IUPAC name is ethane;(5Z,7Z)-3-fluoro-4-methyldeca-5,7,9-trien-2-one;2-methylbutane.
| Compound Name | ethane;(5Z,7Z)-3-fluoro-4-methyldeca-5,7,9-trien-2-one;2-methylbutane |
|---|---|
| PubChem CID | 143351155 |
| Molecular Formula | C18H33FO |
| Molecular Weight | 284.46 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | ethane;(5Z,7Z)-3-fluoro-4-methyldeca-5,7,9-trien-2-one;2-methylbutane |
| SMILES | C=C/C=C\C=C/C(C)C(F)C(C)=O.CC.CCC(C)C |
| InChI | InChI=1S/C11H15FO.C5H12.C2H6/c1-4-5-6-7-8-9(2)11(12)10(3)13;1-4-5(2)3;1-2/h4-9,11H,1H2,2-3H3;5H,4H2,1-3H3;1-2H3/b6-5-,8-7-;; |
| InChIKey | DQOYIBAUZLDCQQ-SVHZMUBJSA-N |
| XLogP | 5.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|