C5H10O2 — CID 87754031
pent-1-ene-2,3-diol (PubChem CID 87754031) has the molecular formula C5H10O2 and a molecular weight of 102.13 g/mol. Its IUPAC name is pent-1-ene-2,3-diol.
| Compound Name | pent-1-ene-2,3-diol |
|---|---|
| PubChem CID | 87754031 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | pent-1-ene-2,3-diol |
| SMILES | C=C(O)C(O)CC |
| InChI | InChI=1S/C5H10O2/c1-3-5(7)4(2)6/h5-7H,2-3H2,1H3 |
| InChIKey | AMGUEVCBLPQRMO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|