C14H24O3 — CID 145420961
ethane;ethyl (3S,4E,5Z)-4-ethylidene-3-hydroxyocta-5,7-dienoate (PubChem CID 145420961) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is ethane;ethyl (3S,4E,5Z)-4-ethylidene-3-hydroxyocta-5,7-dienoate.
| Compound Name | ethane;ethyl (3S,4E,5Z)-4-ethylidene-3-hydroxyocta-5,7-dienoate |
|---|---|
| PubChem CID | 145420961 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | ethane;ethyl (3S,4E,5Z)-4-ethylidene-3-hydroxyocta-5,7-dienoate |
| SMILES | C=C/C=C\C(=C/C)[C@@H](O)CC(=O)OCC.CC |
| InChI | InChI=1S/C12H18O3.C2H6/c1-4-7-8-10(5-2)11(13)9-12(14)15-6-3;1-2/h4-5,7-8,11,13H,1,6,9H2,2-3H3;1-2H3/b8-7-,10-5+;/t11-;/m0./s1 |
| InChIKey | HWMXXGPIMMTLIS-YDGJSGEJSA-N |
| XLogP | 3.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|