(E)-2,3-dihydroxypent-3-enoic acid

C5H8O4 — CID 173482336

IUPAC(E)-2,3-dihydroxypent-3-enoic acid
SMILESC/C=C(/O)C(O)C(=O)O
InChIInChI=1S/C5H8O4/c1-2-3(6)4(7)5(8)9/h2,4,6-7H,1H3,(H,8,9)/b3-2+
InChIKeyGHQLBHLUOMYPCD-NSCUHMNNSA-N
MW132.11 g/mol
LogP-0.11
Rot. Bonds2

About (E)-2,3-dihydroxypent-3-enoic acid

(E)-2,3-dihydroxypent-3-enoic acid (PubChem CID 173482336) has the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. Its IUPAC name is (E)-2,3-dihydroxypent-3-enoic acid.

Molecular Properties

Compound Name(E)-2,3-dihydroxypent-3-enoic acid
PubChem CID173482336
Molecular FormulaC5H8O4
Molecular Weight132.11 g/mol
Exact Mass132.04
IUPAC Name(E)-2,3-dihydroxypent-3-enoic acid
SMILESC/C=C(/O)C(O)C(=O)O
InChIInChI=1S/C5H8O4/c1-2-3(6)4(7)5(8)9/h2,4,6-7H,1H3,(H,8,9)/b3-2+
InChIKeyGHQLBHLUOMYPCD-NSCUHMNNSA-N
XLogP-0.11
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.11
LogP ≤ 5-0.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}

Analyze (E)-2,3-dihydroxypent-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2,3-dihydroxypent-3-enoic acid?
The IUPAC name of (E)-2,3-dihydroxypent-3-enoic acid (CID 173482336) is (E)-2,3-dihydroxypent-3-enoic acid.
What is the SMILES notation for (E)-2,3-dihydroxypent-3-enoic acid?
The canonical SMILES for (E)-2,3-dihydroxypent-3-enoic acid is C/C=C(/O)C(O)C(=O)O.
What is the InChIKey of (E)-2,3-dihydroxypent-3-enoic acid?
The InChIKey is GHQLBHLUOMYPCD-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H8O4/c1-2-3(6)4(7)5(8)9/h2,4,6-7H,1H3,(H,8,9)/b3-2+.
What are the key properties of (E)-2,3-dihydroxypent-3-enoic acid?
(E)-2,3-dihydroxypent-3-enoic acid has a molecular weight of 132.11 g/mol, XLogP of -0.11, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-dihydroxypent-3-enoic acid is sourced from PubChem (CID 173482336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).