C5H8O4 — CID 173482336
(E)-2,3-dihydroxypent-3-enoic acid (PubChem CID 173482336) has the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. Its IUPAC name is (E)-2,3-dihydroxypent-3-enoic acid.
| Compound Name | (E)-2,3-dihydroxypent-3-enoic acid |
|---|---|
| PubChem CID | 173482336 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (E)-2,3-dihydroxypent-3-enoic acid |
| SMILES | C/C=C(/O)C(O)C(=O)O |
| InChI | InChI=1S/C5H8O4/c1-2-3(6)4(7)5(8)9/h2,4,6-7H,1H3,(H,8,9)/b3-2+ |
| InChIKey | GHQLBHLUOMYPCD-NSCUHMNNSA-N |
| XLogP | -0.11 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|