2-hydroxy-3-oxopentanoic acid

C5H8O4 — CID 71338185

IUPAC2-hydroxy-3-oxopentanoic acid
SMILESCCC(=O)C(O)C(=O)O
InChIInChI=1S/C5H8O4/c1-2-3(6)4(7)5(8)9/h4,7H,2H2,1H3,(H,8,9)
InChIKeyVYWBMMZOBUQRRU-UHFFFAOYSA-N
MW132.11 g/mol
LogP-0.59
Rot. Bonds3

About 2-hydroxy-3-oxopentanoic acid

2-hydroxy-3-oxopentanoic acid (PubChem CID 71338185) has the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. Its IUPAC name is 2-hydroxy-3-oxopentanoic acid.

Molecular Properties

Compound Name2-hydroxy-3-oxopentanoic acid
PubChem CID71338185
Molecular FormulaC5H8O4
Molecular Weight132.11 g/mol
Exact Mass132.04
IUPAC Name2-hydroxy-3-oxopentanoic acid
SMILESCCC(=O)C(O)C(=O)O
InChIInChI=1S/C5H8O4/c1-2-3(6)4(7)5(8)9/h4,7H,2H2,1H3,(H,8,9)
InChIKeyVYWBMMZOBUQRRU-UHFFFAOYSA-N
XLogP-0.59
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.11
LogP ≤ 5-0.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-hydroxy-3-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-3-oxopentanoic acid?
The IUPAC name of 2-hydroxy-3-oxopentanoic acid (CID 71338185) is 2-hydroxy-3-oxopentanoic acid.
What is the SMILES notation for 2-hydroxy-3-oxopentanoic acid?
The canonical SMILES for 2-hydroxy-3-oxopentanoic acid is CCC(=O)C(O)C(=O)O.
What is the InChIKey of 2-hydroxy-3-oxopentanoic acid?
The InChIKey is VYWBMMZOBUQRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4/c1-2-3(6)4(7)5(8)9/h4,7H,2H2,1H3,(H,8,9).
What are the key properties of 2-hydroxy-3-oxopentanoic acid?
2-hydroxy-3-oxopentanoic acid has a molecular weight of 132.11 g/mol, XLogP of -0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-oxopentanoic acid is sourced from PubChem (CID 71338185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).