C10H16O4 — CID 139635405
(E)-4,7-dihydroxydec-5-ene-3,8-dione (PubChem CID 139635405) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (E)-4,7-dihydroxydec-5-ene-3,8-dione.
| Compound Name | (E)-4,7-dihydroxydec-5-ene-3,8-dione |
|---|---|
| PubChem CID | 139635405 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (E)-4,7-dihydroxydec-5-ene-3,8-dione |
| SMILES | CCC(=O)C(O)/C=C/C(O)C(=O)CC |
| InChI | InChI=1S/C10H16O4/c1-3-7(11)9(13)5-6-10(14)8(12)4-2/h5-6,9-10,13-14H,3-4H2,1-2H3/b6-5+ |
| InChIKey | OJAZROMWSXZRSG-AATRIKPKSA-N |
| XLogP | 0.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|