About (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one
(4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one (PubChem CID 130664474) has the molecular formula C6H11ClO3
and a molecular weight of 166.60 g/mol. Its IUPAC name is (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one.
Molecular Properties
| Compound Name | (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one |
| PubChem CID | 130664474 |
| Molecular Formula | C6H11ClO3 |
| Molecular Weight | 166.60 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one |
| SMILES | CCC(=O)[C@@H](O)[C@H](O)CCl |
| InChI | InChI=1S/C6H11ClO3/c1-2-4(8)6(10)5(9)3-7/h5-6,9-10H,2-3H2,1H3/t5-,6-/m1/s1 |
| InChIKey | LYLMEHZIHJLISS-PHDIDXHHSA-N |
| XLogP | -0.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.60 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one?
The IUPAC name of (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one (CID 130664474) is (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one.
What is the SMILES notation for (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one?
The canonical SMILES for (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one is CCC(=O)[C@@H](O)[C@H](O)CCl.
What is the InChIKey of (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one?
The InChIKey is LYLMEHZIHJLISS-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H11ClO3/c1-2-4(8)6(10)5(9)3-7/h5-6,9-10H,2-3H2,1H3/t5-,6-/m1/s1.
What are the key properties of (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one?
(4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one has a molecular weight of 166.60 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-6-chloro-4,5-dihydroxyhexan-3-one is sourced from PubChem (CID 130664474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).