C9H16O5 — CID 88863835
methyl 2,4-dihydroxy-3-methyl-5-oxoheptanoate (PubChem CID 88863835) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is methyl 2,4-dihydroxy-3-methyl-5-oxoheptanoate.
| Compound Name | methyl 2,4-dihydroxy-3-methyl-5-oxoheptanoate |
|---|---|
| PubChem CID | 88863835 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | methyl 2,4-dihydroxy-3-methyl-5-oxoheptanoate |
| SMILES | CCC(=O)C(O)C(C)C(O)C(=O)OC |
| InChI | InChI=1S/C9H16O5/c1-4-6(10)7(11)5(2)8(12)9(13)14-3/h5,7-8,11-12H,4H2,1-3H3 |
| InChIKey | DDTOBGAVDHNVAT-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |