About carbonic acid;2-hydroxypentan-3-one
carbonic acid;2-hydroxypentan-3-one (PubChem CID 174710122) has the molecular formula C6H12O5
and a molecular weight of 164.16 g/mol. Its IUPAC name is carbonic acid;2-hydroxypentan-3-one.
Molecular Properties
| Compound Name | carbonic acid;2-hydroxypentan-3-one |
| PubChem CID | 174710122 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | carbonic acid;2-hydroxypentan-3-one |
| SMILES | CCC(=O)C(C)O.O=C(O)O |
| InChI | InChI=1S/C5H10O2.CH2O3/c1-3-5(7)4(2)6;2-1(3)4/h4,6H,3H2,1-2H3;(H2,2,3,4) |
| InChIKey | VQVVORGMTDDOCE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;2-hydroxypentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;2-hydroxypentan-3-one?
The IUPAC name of carbonic acid;2-hydroxypentan-3-one (CID 174710122) is carbonic acid;2-hydroxypentan-3-one.
What is the SMILES notation for carbonic acid;2-hydroxypentan-3-one?
The canonical SMILES for carbonic acid;2-hydroxypentan-3-one is CCC(=O)C(C)O.O=C(O)O.
What is the InChIKey of carbonic acid;2-hydroxypentan-3-one?
The InChIKey is VQVVORGMTDDOCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.CH2O3/c1-3-5(7)4(2)6;2-1(3)4/h4,6H,3H2,1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;2-hydroxypentan-3-one?
carbonic acid;2-hydroxypentan-3-one has a molecular weight of 164.16 g/mol, XLogP of 0.57, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;2-hydroxypentan-3-one is sourced from PubChem (CID 174710122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).