About 4-hydroxyheptane-3,5-dione;uranium
4-hydroxyheptane-3,5-dione;uranium (PubChem CID 59435078) has the molecular formula C7H12O3U
and a molecular weight of 382.20 g/mol. Its IUPAC name is 4-hydroxyheptane-3,5-dione;uranium.
Molecular Properties
| Compound Name | 4-hydroxyheptane-3,5-dione;uranium |
| PubChem CID | 59435078 |
| Molecular Formula | C7H12O3U |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-hydroxyheptane-3,5-dione;uranium |
| SMILES | CCC(=O)C(O)C(=O)CC.[U] |
| InChI | InChI=1S/C7H12O3.U/c1-3-5(8)7(10)6(9)4-2;/h7,10H,3-4H2,1-2H3; |
| InChIKey | LVUWNYUPUAHWMD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxyheptane-3,5-dione;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxyheptane-3,5-dione;uranium?
The IUPAC name of 4-hydroxyheptane-3,5-dione;uranium (CID 59435078) is 4-hydroxyheptane-3,5-dione;uranium.
What is the SMILES notation for 4-hydroxyheptane-3,5-dione;uranium?
The canonical SMILES for 4-hydroxyheptane-3,5-dione;uranium is CCC(=O)C(O)C(=O)CC.[U].
What is the InChIKey of 4-hydroxyheptane-3,5-dione;uranium?
The InChIKey is LVUWNYUPUAHWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.U/c1-3-5(8)7(10)6(9)4-2;/h7,10H,3-4H2,1-2H3;.
What are the key properties of 4-hydroxyheptane-3,5-dione;uranium?
4-hydroxyheptane-3,5-dione;uranium has a molecular weight of 382.20 g/mol, XLogP of 0.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxyheptane-3,5-dione;uranium is sourced from PubChem (CID 59435078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).